C10H13N3O — CID 114390009
N-but-3-yn-2-yl-3-pyrazol-1-ylpropanamide (PubChem CID 114390009) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is N-but-3-yn-2-yl-3-pyrazol-1-ylpropanamide.
| Compound Name | N-but-3-yn-2-yl-3-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 114390009 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N-but-3-yn-2-yl-3-pyrazol-1-ylpropanamide |
| SMILES | C#CC(C)NC(=O)CCn1cccn1 |
| InChI | InChI=1S/C10H13N3O/c1-3-9(2)12-10(14)5-8-13-7-4-6-11-13/h1,4,6-7,9H,5,8H2,2H3,(H,12,14) |
| InChIKey | FAYKIPKMSRIOKN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|