C12H19N3O3 — CID 113353064
(2R)-3,3-dimethyl-2-(3-pyrazol-1-ylpropanoylamino)butanoic acid (PubChem CID 113353064) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is (2R)-3,3-dimethyl-2-(3-pyrazol-1-ylpropanoylamino)butanoic acid.
| Compound Name | (2R)-3,3-dimethyl-2-(3-pyrazol-1-ylpropanoylamino)butanoic acid |
|---|---|
| PubChem CID | 113353064 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | (2R)-3,3-dimethyl-2-(3-pyrazol-1-ylpropanoylamino)butanoic acid |
| SMILES | CC(C)(C)[C@@H](NC(=O)CCn1cccn1)C(=O)O |
| InChI | InChI=1S/C12H19N3O3/c1-12(2,3)10(11(17)18)14-9(16)5-8-15-7-4-6-13-15/h4,6-7,10H,5,8H2,1-3H3,(H,14,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | SZMSPMOVHPFTSH-JTQLQIEISA-N |
| XLogP | 0.89 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |