C12H23N5O — CID 113412705
N-(3-methylbutan-2-yl)-2-[3-(triazol-1-yl)propylamino]acetamide (PubChem CID 113412705) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is N-(3-methylbutan-2-yl)-2-[3-(triazol-1-yl)propylamino]acetamide.
| Compound Name | N-(3-methylbutan-2-yl)-2-[3-(triazol-1-yl)propylamino]acetamide |
|---|---|
| PubChem CID | 113412705 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | N-(3-methylbutan-2-yl)-2-[3-(triazol-1-yl)propylamino]acetamide |
| SMILES | CC(C)C(C)NC(=O)CNCCCn1ccnn1 |
| InChI | InChI=1S/C12H23N5O/c1-10(2)11(3)15-12(18)9-13-5-4-7-17-8-6-14-16-17/h6,8,10-11,13H,4-5,7,9H2,1-3H3,(H,15,18) |
| InChIKey | ISZRWXJUBQSKMT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|