C10H19N5O — CID 43601596
N-[3-(ethylamino)propyl]-3-(triazol-1-yl)propanamide (PubChem CID 43601596) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is N-[3-(ethylamino)propyl]-3-(triazol-1-yl)propanamide.
| Compound Name | N-[3-(ethylamino)propyl]-3-(triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 43601596 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N-[3-(ethylamino)propyl]-3-(triazol-1-yl)propanamide |
| SMILES | CCNCCCNC(=O)CCn1ccnn1 |
| InChI | InChI=1S/C10H19N5O/c1-2-11-5-3-6-12-10(16)4-8-15-9-7-13-14-15/h7,9,11H,2-6,8H2,1H3,(H,12,16) |
| InChIKey | YJBFACSLYHSDOG-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|