C9H14N4O3 — CID 115348185
5-[[2-(triazol-1-yl)acetyl]amino]pentanoic acid (PubChem CID 115348185) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 5-[[2-(triazol-1-yl)acetyl]amino]pentanoic acid.
| Compound Name | 5-[[2-(triazol-1-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 115348185 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5-[[2-(triazol-1-yl)acetyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)Cn1ccnn1 |
| InChI | InChI=1S/C9H14N4O3/c14-8(7-13-6-5-11-12-13)10-4-2-1-3-9(15)16/h5-6H,1-4,7H2,(H,10,14)(H,15,16) |
| InChIKey | DWSDHTXJWWRSFJ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|