C10H17N5O3 — CID 24702857
7-[[2-(tetrazol-1-yl)acetyl]amino]heptanoic acid (PubChem CID 24702857) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is 7-[[2-(tetrazol-1-yl)acetyl]amino]heptanoic acid.
| Compound Name | 7-[[2-(tetrazol-1-yl)acetyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 24702857 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 7-[[2-(tetrazol-1-yl)acetyl]amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)Cn1cnnn1 |
| InChI | InChI=1S/C10H17N5O3/c16-9(7-15-8-12-13-14-15)11-6-4-2-1-3-5-10(17)18/h8H,1-7H2,(H,11,16)(H,17,18) |
| InChIKey | BWPVDLZZWQENNT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|