C5H9N5O — CID 130679342
N-ethyl-2-(tetrazol-1-yl)acetamide (PubChem CID 130679342) has the molecular formula C5H9N5O and a molecular weight of 155.16 g/mol. Its IUPAC name is N-ethyl-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-ethyl-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 130679342 |
| Molecular Formula | C5H9N5O |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | N-ethyl-2-(tetrazol-1-yl)acetamide |
| SMILES | CCNC(=O)Cn1cnnn1 |
| InChI | InChI=1S/C5H9N5O/c1-2-6-5(11)3-10-4-7-8-9-10/h4H,2-3H2,1H3,(H,6,11) |
| InChIKey | QTNCPJUFUDFOLT-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |