C18H27N7O — CID 60559251
N-[4-(4-benzylpiperazin-1-yl)butyl]-2-(tetrazol-1-yl)acetamide (PubChem CID 60559251) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)butyl]-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)butyl]-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 60559251 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)butyl]-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnnn1)NCCCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N7O/c26-18(15-25-16-20-21-22-25)19-8-4-5-9-23-10-12-24(13-11-23)14-17-6-2-1-3-7-17/h1-3,6-7,16H,4-5,8-15H2,(H,19,26) |
| InChIKey | RKVQNVTYFURIMM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|