C8H12N4O — CID 114618475
N-(2-methylprop-2-enyl)-2-(triazol-1-yl)acetamide (PubChem CID 114618475) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is N-(2-methylprop-2-enyl)-2-(triazol-1-yl)acetamide.
| Compound Name | N-(2-methylprop-2-enyl)-2-(triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 114618475 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | N-(2-methylprop-2-enyl)-2-(triazol-1-yl)acetamide |
| SMILES | C=C(C)CNC(=O)Cn1ccnn1 |
| InChI | InChI=1S/C8H12N4O/c1-7(2)5-9-8(13)6-12-4-3-10-11-12/h3-4H,1,5-6H2,2H3,(H,9,13) |
| InChIKey | XQEBBRFFBGBWKR-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|