C8H14N4O2 — CID 104981673
N-[(2S)-1-hydroxybutan-2-yl]-2-(triazol-1-yl)acetamide (PubChem CID 104981673) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is N-[(2S)-1-hydroxybutan-2-yl]-2-(triazol-1-yl)acetamide.
| Compound Name | N-[(2S)-1-hydroxybutan-2-yl]-2-(triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 104981673 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | N-[(2S)-1-hydroxybutan-2-yl]-2-(triazol-1-yl)acetamide |
| SMILES | CC[C@@H](CO)NC(=O)Cn1ccnn1 |
| InChI | InChI=1S/C8H14N4O2/c1-2-7(6-13)10-8(14)5-12-4-3-9-11-12/h3-4,7,13H,2,5-6H2,1H3,(H,10,14)/t7-/m0/s1 |
| InChIKey | WCAYBSZAOKRHIR-ZETCQYMHSA-N |
| XLogP | -0.83 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |