C9H16N4O2 — CID 107211178
2-(4-aminopyrazol-1-yl)-N-[(2R)-1-hydroxybutan-2-yl]acetamide (PubChem CID 107211178) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-(4-aminopyrazol-1-yl)-N-[(2R)-1-hydroxybutan-2-yl]acetamide.
| Compound Name | 2-(4-aminopyrazol-1-yl)-N-[(2R)-1-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 107211178 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-(4-aminopyrazol-1-yl)-N-[(2R)-1-hydroxybutan-2-yl]acetamide |
| SMILES | CC[C@H](CO)NC(=O)Cn1cc(N)cn1 |
| InChI | InChI=1S/C9H16N4O2/c1-2-8(6-14)12-9(15)5-13-4-7(10)3-11-13/h3-4,8,14H,2,5-6,10H2,1H3,(H,12,15)/t8-/m1/s1 |
| InChIKey | ZDXKDWCORCRNJL-MRVPVSSYSA-N |
| XLogP | -0.65 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |