C9H17N5O — CID 165480854
2-(4-aminotriazol-1-yl)-N-pentan-3-ylacetamide (PubChem CID 165480854) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-(4-aminotriazol-1-yl)-N-pentan-3-ylacetamide.
| Compound Name | 2-(4-aminotriazol-1-yl)-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 165480854 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-(4-aminotriazol-1-yl)-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)Cn1cc(N)nn1 |
| InChI | InChI=1S/C9H17N5O/c1-3-7(4-2)11-9(15)6-14-5-8(10)12-13-14/h5,7H,3-4,6,10H2,1-2H3,(H,11,15) |
| InChIKey | VLTXDFGCFVEAGZ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |