C12H22N6O2 — CID 114778830
2-amino-N-[[1-[2-oxo-2-(pentan-3-ylamino)ethyl]triazol-4-yl]methyl]acetamide (PubChem CID 114778830) has the molecular formula C12H22N6O2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-amino-N-[[1-[2-oxo-2-(pentan-3-ylamino)ethyl]triazol-4-yl]methyl]acetamide.
| Compound Name | 2-amino-N-[[1-[2-oxo-2-(pentan-3-ylamino)ethyl]triazol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 114778830 |
| Molecular Formula | C12H22N6O2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-amino-N-[[1-[2-oxo-2-(pentan-3-ylamino)ethyl]triazol-4-yl]methyl]acetamide |
| SMILES | CCC(CC)NC(=O)Cn1cc(CNC(=O)CN)nn1 |
| InChI | InChI=1S/C12H22N6O2/c1-3-9(4-2)15-12(20)8-18-7-10(16-17-18)6-14-11(19)5-13/h7,9H,3-6,8,13H2,1-2H3,(H,14,19)(H,15,20) |
| InChIKey | FURAWSSJFWLGIV-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |