C10H18FN5O — CID 114280351
2-amino-N-[[1-(5-fluoropentyl)triazol-4-yl]methyl]acetamide (PubChem CID 114280351) has the molecular formula C10H18FN5O and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-amino-N-[[1-(5-fluoropentyl)triazol-4-yl]methyl]acetamide.
| Compound Name | 2-amino-N-[[1-(5-fluoropentyl)triazol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 114280351 |
| Molecular Formula | C10H18FN5O |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 2-amino-N-[[1-(5-fluoropentyl)triazol-4-yl]methyl]acetamide |
| SMILES | NCC(=O)NCc1cn(CCCCCF)nn1 |
| InChI | InChI=1S/C10H18FN5O/c11-4-2-1-3-5-16-8-9(14-15-16)7-13-10(17)6-12/h8H,1-7,12H2,(H,13,17) |
| InChIKey | DQOMIOQZOCVIDP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|