C13H16N6O2 — CID 114778729
4-[[4-[[(2-aminoacetyl)amino]methyl]triazol-1-yl]methyl]benzamide (PubChem CID 114778729) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 4-[[4-[[(2-aminoacetyl)amino]methyl]triazol-1-yl]methyl]benzamide.
| Compound Name | 4-[[4-[[(2-aminoacetyl)amino]methyl]triazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 114778729 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-[[4-[[(2-aminoacetyl)amino]methyl]triazol-1-yl]methyl]benzamide |
| SMILES | NCC(=O)NCc1cn(Cc2ccc(C(N)=O)cc2)nn1 |
| InChI | InChI=1S/C13H16N6O2/c14-5-12(20)16-6-11-8-19(18-17-11)7-9-1-3-10(4-2-9)13(15)21/h1-4,8H,5-7,14H2,(H2,15,21)(H,16,20) |
| InChIKey | DWIAQVGKOREYME-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |