About propanoic acid;4-(triazol-1-yl)butanoic acid
propanoic acid;4-(triazol-1-yl)butanoic acid (PubChem CID 175246516) has the molecular formula C9H15N3O4
and a molecular weight of 229.24 g/mol. Its IUPAC name is propanoic acid;4-(triazol-1-yl)butanoic acid.
Molecular Properties
| Compound Name | propanoic acid;4-(triazol-1-yl)butanoic acid |
| PubChem CID | 175246516 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | propanoic acid;4-(triazol-1-yl)butanoic acid |
| SMILES | CCC(=O)O.O=C(O)CCCn1ccnn1 |
| InChI | InChI=1S/C6H9N3O2.C3H6O2/c10-6(11)2-1-4-9-5-3-7-8-9;1-2-3(4)5/h3,5H,1-2,4H2,(H,10,11);2H2,1H3,(H,4,5) |
| InChIKey | ROORSTVXYJQROU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propanoic acid;4-(triazol-1-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoic acid;4-(triazol-1-yl)butanoic acid?
The IUPAC name of propanoic acid;4-(triazol-1-yl)butanoic acid (CID 175246516) is propanoic acid;4-(triazol-1-yl)butanoic acid.
What is the SMILES notation for propanoic acid;4-(triazol-1-yl)butanoic acid?
The canonical SMILES for propanoic acid;4-(triazol-1-yl)butanoic acid is CCC(=O)O.O=C(O)CCCn1ccnn1.
What is the InChIKey of propanoic acid;4-(triazol-1-yl)butanoic acid?
The InChIKey is ROORSTVXYJQROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2.C3H6O2/c10-6(11)2-1-4-9-5-3-7-8-9;1-2-3(4)5/h3,5H,1-2,4H2,(H,10,11);2H2,1H3,(H,4,5).
What are the key properties of propanoic acid;4-(triazol-1-yl)butanoic acid?
propanoic acid;4-(triazol-1-yl)butanoic acid has a molecular weight of 229.24 g/mol, XLogP of 0.62, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propanoic acid;4-(triazol-1-yl)butanoic acid is sourced from PubChem (CID 175246516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).