About 9-pyrazol-1-ylnonanoic acid;hydrate
9-pyrazol-1-ylnonanoic acid;hydrate (PubChem CID 67940849) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is 9-pyrazol-1-ylnonanoic acid;hydrate.
Molecular Properties
| Compound Name | 9-pyrazol-1-ylnonanoic acid;hydrate |
| PubChem CID | 67940849 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 9-pyrazol-1-ylnonanoic acid;hydrate |
| SMILES | O.O=C(O)CCCCCCCCn1cccn1 |
| InChI | InChI=1S/C12H20N2O2.H2O/c15-12(16)8-5-3-1-2-4-6-10-14-11-7-9-13-14;/h7,9,11H,1-6,8,10H2,(H,15,16);1H2 |
| InChIKey | RQTBRTOGBUUEFS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-pyrazol-1-ylnonanoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-pyrazol-1-ylnonanoic acid;hydrate?
The IUPAC name of 9-pyrazol-1-ylnonanoic acid;hydrate (CID 67940849) is 9-pyrazol-1-ylnonanoic acid;hydrate.
What is the SMILES notation for 9-pyrazol-1-ylnonanoic acid;hydrate?
The canonical SMILES for 9-pyrazol-1-ylnonanoic acid;hydrate is O.O=C(O)CCCCCCCCn1cccn1.
What is the InChIKey of 9-pyrazol-1-ylnonanoic acid;hydrate?
The InChIKey is RQTBRTOGBUUEFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2.H2O/c15-12(16)8-5-3-1-2-4-6-10-14-11-7-9-13-14;/h7,9,11H,1-6,8,10H2,(H,15,16);1H2.
What are the key properties of 9-pyrazol-1-ylnonanoic acid;hydrate?
9-pyrazol-1-ylnonanoic acid;hydrate has a molecular weight of 242.32 g/mol, XLogP of 1.87, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-pyrazol-1-ylnonanoic acid;hydrate is sourced from PubChem (CID 67940849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).