C9H14N4O3 — CID 81456321
4-[methyl-[2-(triazol-1-yl)acetyl]amino]butanoic acid (PubChem CID 81456321) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 4-[methyl-[2-(triazol-1-yl)acetyl]amino]butanoic acid.
| Compound Name | 4-[methyl-[2-(triazol-1-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 81456321 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-[methyl-[2-(triazol-1-yl)acetyl]amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)Cn1ccnn1 |
| InChI | InChI=1S/C9H14N4O3/c1-12(5-2-3-9(15)16)8(14)7-13-6-4-10-11-13/h4,6H,2-3,5,7H2,1H3,(H,15,16) |
| InChIKey | YYNAFMLCNYJTLY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |