C14H17N5O3 — CID 119173060
4-[methyl-[2-(5-phenyltetrazol-2-yl)acetyl]amino]butanoic acid (PubChem CID 119173060) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-[methyl-[2-(5-phenyltetrazol-2-yl)acetyl]amino]butanoic acid.
| Compound Name | 4-[methyl-[2-(5-phenyltetrazol-2-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119173060 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-[methyl-[2-(5-phenyltetrazol-2-yl)acetyl]amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)Cn1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H17N5O3/c1-18(9-5-8-13(21)22)12(20)10-19-16-14(15-17-19)11-6-3-2-4-7-11/h2-4,6-7H,5,8-10H2,1H3,(H,21,22) |
| InChIKey | LDQSYPYBRFKCRZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |