C12H15N5O3S — CID 43172401
4-[methyl-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]amino]butanoic acid (PubChem CID 43172401) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is 4-[methyl-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]amino]butanoic acid.
| Compound Name | 4-[methyl-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43172401 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-[methyl-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)Cn1nnc(-c2cccs2)n1 |
| InChI | InChI=1S/C12H15N5O3S/c1-16(6-2-5-11(19)20)10(18)8-17-14-12(13-15-17)9-4-3-7-21-9/h3-4,7H,2,5-6,8H2,1H3,(H,19,20) |
| InChIKey | GHMFRPLKZFHEKQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |