C10H11N5O3S — CID 43354761
3-[[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]amino]propanoic acid (PubChem CID 43354761) has the molecular formula C10H11N5O3S and a molecular weight of 281.30 g/mol. Its IUPAC name is 3-[[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43354761 |
| Molecular Formula | C10H11N5O3S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3-[[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)Cn1nnc(-c2cccs2)n1 |
| InChI | InChI=1S/C10H11N5O3S/c16-8(11-4-3-9(17)18)6-15-13-10(12-14-15)7-2-1-5-19-7/h1-2,5H,3-4,6H2,(H,11,16)(H,17,18) |
| InChIKey | UHMOPSKAINTLQM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |