C13H19N5O2S — CID 107843843
N-(6-hydroxyhexyl)-2-(5-thiophen-2-yltetrazol-2-yl)acetamide (PubChem CID 107843843) has the molecular formula C13H19N5O2S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-2-(5-thiophen-2-yltetrazol-2-yl)acetamide.
| Compound Name | N-(6-hydroxyhexyl)-2-(5-thiophen-2-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 107843843 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-(6-hydroxyhexyl)-2-(5-thiophen-2-yltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2cccs2)n1)NCCCCCCO |
| InChI | InChI=1S/C13H19N5O2S/c19-8-4-2-1-3-7-14-12(20)10-18-16-13(15-17-18)11-6-5-9-21-11/h5-6,9,19H,1-4,7-8,10H2,(H,14,20) |
| InChIKey | ULFVEGLRRXSNAE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|