C12H17N5O2S — CID 107318628
N-(5-hydroxypentyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide (PubChem CID 107318628) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide.
| Compound Name | N-(5-hydroxypentyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 107318628 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-(5-hydroxypentyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccsc2)n1)NCCCCCO |
| InChI | InChI=1S/C12H17N5O2S/c18-6-3-1-2-5-13-11(19)8-17-15-12(14-16-17)10-4-7-20-9-10/h4,7,9,18H,1-3,5-6,8H2,(H,13,19) |
| InChIKey | LKRGYBOMSKJKID-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|