C13H19N5O2S — CID 103862002
N-(5-hydroxy-4-methylpentyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide (PubChem CID 103862002) has the molecular formula C13H19N5O2S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(5-hydroxy-4-methylpentyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide.
| Compound Name | N-(5-hydroxy-4-methylpentyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 103862002 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-(5-hydroxy-4-methylpentyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
| SMILES | CC(CO)CCCNC(=O)Cn1nnc(-c2ccsc2)n1 |
| InChI | InChI=1S/C13H19N5O2S/c1-10(8-19)3-2-5-14-12(20)7-18-16-13(15-17-18)11-4-6-21-9-11/h4,6,9-10,19H,2-3,5,7-8H2,1H3,(H,14,20) |
| InChIKey | LNDNMYMYILUOPI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|