C17H19N5OS — CID 9128343
N-[(1R)-1-(4-ethylphenyl)ethyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetamide (PubChem CID 9128343) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[(1R)-1-(4-ethylphenyl)ethyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetamide.
| Compound Name | N-[(1R)-1-(4-ethylphenyl)ethyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9128343 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-[(1R)-1-(4-ethylphenyl)ethyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
| SMILES | CCc1ccc([C@@H](C)NC(=O)Cn2nnc(-c3ccsc3)n2)cc1 |
| InChI | InChI=1S/C17H19N5OS/c1-3-13-4-6-14(7-5-13)12(2)18-16(23)10-22-20-17(19-21-22)15-8-9-24-11-15/h4-9,11-12H,3,10H2,1-2H3,(H,18,23)/t12-/m1/s1 |
| InChIKey | QYADBMDGIZQMEE-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |