C15H13N5O3S — CID 9128050
methyl 4-[[2-(5-thiophen-3-yltetrazol-2-yl)acetyl]amino]benzoate (PubChem CID 9128050) has the molecular formula C15H13N5O3S and a molecular weight of 343.37 g/mol. Its IUPAC name is methyl 4-[[2-(5-thiophen-3-yltetrazol-2-yl)acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(5-thiophen-3-yltetrazol-2-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 9128050 |
| Molecular Formula | C15H13N5O3S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | methyl 4-[[2-(5-thiophen-3-yltetrazol-2-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Cn2nnc(-c3ccsc3)n2)cc1 |
| InChI | InChI=1S/C15H13N5O3S/c1-23-15(22)10-2-4-12(5-3-10)16-13(21)8-20-18-14(17-19-20)11-6-7-24-9-11/h2-7,9H,8H2,1H3,(H,16,21) |
| InChIKey | WDDPVTXAKVBOQP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |