C9H11N5O2S — CID 43416200
N-(2-hydroxyethyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide (PubChem CID 43416200) has the molecular formula C9H11N5O2S and a molecular weight of 253.29 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 43416200 |
| Molecular Formula | C9H11N5O2S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | N-(2-hydroxyethyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccsc2)n1)NCCO |
| InChI | InChI=1S/C9H11N5O2S/c15-3-2-10-8(16)5-14-12-9(11-13-14)7-1-4-17-6-7/h1,4,6,15H,2-3,5H2,(H,10,16) |
| InChIKey | GOLPYFKSWLBJLN-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |