C11H13N5O3S — CID 43245246
4-[[2-(5-thiophen-3-yltetrazol-2-yl)acetyl]amino]butanoic acid (PubChem CID 43245246) has the molecular formula C11H13N5O3S and a molecular weight of 295.32 g/mol. Its IUPAC name is 4-[[2-(5-thiophen-3-yltetrazol-2-yl)acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-(5-thiophen-3-yltetrazol-2-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43245246 |
| Molecular Formula | C11H13N5O3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 4-[[2-(5-thiophen-3-yltetrazol-2-yl)acetyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Cn1nnc(-c2ccsc2)n1 |
| InChI | InChI=1S/C11H13N5O3S/c17-9(12-4-1-2-10(18)19)6-16-14-11(13-15-16)8-3-5-20-7-8/h3,5,7H,1-2,4,6H2,(H,12,17)(H,18,19) |
| InChIKey | MDLTUPLVSDYZFK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|