C8H9N5O2S — CID 60709492
N-methoxy-2-(5-thiophen-3-yltetrazol-2-yl)acetamide (PubChem CID 60709492) has the molecular formula C8H9N5O2S and a molecular weight of 239.26 g/mol. Its IUPAC name is N-methoxy-2-(5-thiophen-3-yltetrazol-2-yl)acetamide.
| Compound Name | N-methoxy-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 60709492 |
| Molecular Formula | C8H9N5O2S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | N-methoxy-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
| SMILES | CONC(=O)Cn1nnc(-c2ccsc2)n1 |
| InChI | InChI=1S/C8H9N5O2S/c1-15-11-7(14)4-13-10-8(9-12-13)6-2-3-16-5-6/h2-3,5H,4H2,1H3,(H,11,14) |
| InChIKey | CFRZPGGZUKMYDM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|