C16H14N4O4S — CID 8677789
[2-(4-methoxyphenyl)-2-oxoethyl] 2-(5-thiophen-3-yltetrazol-2-yl)acetate (PubChem CID 8677789) has the molecular formula C16H14N4O4S and a molecular weight of 358.38 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 2-(5-thiophen-3-yltetrazol-2-yl)acetate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-(5-thiophen-3-yltetrazol-2-yl)acetate |
|---|---|
| PubChem CID | 8677789 |
| Molecular Formula | C16H14N4O4S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-(5-thiophen-3-yltetrazol-2-yl)acetate |
| SMILES | COc1ccc(C(=O)COC(=O)Cn2nnc(-c3ccsc3)n2)cc1 |
| InChI | InChI=1S/C16H14N4O4S/c1-23-13-4-2-11(3-5-13)14(21)9-24-15(22)8-20-18-16(17-19-20)12-6-7-25-10-12/h2-7,10H,8-9H2,1H3 |
| InChIKey | XKSQTDRDFXNITM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |