C9H9N5O4S — CID 63912512
2-[[2-(5-thiophen-3-yltetrazol-2-yl)acetyl]amino]oxyacetic acid (PubChem CID 63912512) has the molecular formula C9H9N5O4S and a molecular weight of 283.27 g/mol. Its IUPAC name is 2-[[2-(5-thiophen-3-yltetrazol-2-yl)acetyl]amino]oxyacetic acid.
| Compound Name | 2-[[2-(5-thiophen-3-yltetrazol-2-yl)acetyl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 63912512 |
| Molecular Formula | C9H9N5O4S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-[[2-(5-thiophen-3-yltetrazol-2-yl)acetyl]amino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)Cn1nnc(-c2ccsc2)n1 |
| InChI | InChI=1S/C9H9N5O4S/c15-7(12-18-4-8(16)17)3-14-11-9(10-13-14)6-1-2-19-5-6/h1-2,5H,3-4H2,(H,12,15)(H,16,17) |
| InChIKey | DCDYTEHZXYZMEH-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|