C15H13ClN6O3S — CID 9128168
N'-[2-(4-chlorophenoxy)acetyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetohydrazide (PubChem CID 9128168) has the molecular formula C15H13ClN6O3S and a molecular weight of 392.83 g/mol. Its IUPAC name is N'-[2-(4-chlorophenoxy)acetyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetohydrazide.
| Compound Name | N'-[2-(4-chlorophenoxy)acetyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 9128168 |
| Molecular Formula | C15H13ClN6O3S |
| Molecular Weight | 392.83 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N'-[2-(4-chlorophenoxy)acetyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetohydrazide |
| SMILES | O=C(COc1ccc(Cl)cc1)NNC(=O)Cn1nnc(-c2ccsc2)n1 |
| InChI | InChI=1S/C15H13ClN6O3S/c16-11-1-3-12(4-2-11)25-8-14(24)18-17-13(23)7-22-20-15(19-21-22)10-5-6-26-9-10/h1-6,9H,7-8H2,(H,17,23)(H,18,24) |
| InChIKey | KURQDRIGHPOJKT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.83 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|