C14H12ClN5OS — CID 9127998
N-(3-chloro-4-methylphenyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide (PubChem CID 9127998) has the molecular formula C14H12ClN5OS and a molecular weight of 333.80 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9127998 |
| Molecular Formula | C14H12ClN5OS |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nnc(-c3ccsc3)n2)cc1Cl |
| InChI | InChI=1S/C14H12ClN5OS/c1-9-2-3-11(6-12(9)15)16-13(21)7-20-18-14(17-19-20)10-4-5-22-8-10/h2-6,8H,7H2,1H3,(H,16,21) |
| InChIKey | CVCSOVBSBVMYRS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |