C14H10F3N5OS — CID 9128049
2-(5-thiophen-3-yltetrazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 9128049) has the molecular formula C14H10F3N5OS and a molecular weight of 353.33 g/mol. Its IUPAC name is 2-(5-thiophen-3-yltetrazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-thiophen-3-yltetrazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9128049 |
| Molecular Formula | C14H10F3N5OS |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-(5-thiophen-3-yltetrazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cn1nnc(-c2ccsc2)n1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H10F3N5OS/c15-14(16,17)10-1-3-11(4-2-10)18-12(23)7-22-20-13(19-21-22)9-5-6-24-8-9/h1-6,8H,7H2,(H,18,23) |
| InChIKey | HLAVDIJSNPROSS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |