C20H17N5OS — CID 9128153
N-(2-benzylphenyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide (PubChem CID 9128153) has the molecular formula C20H17N5OS and a molecular weight of 375.46 g/mol. Its IUPAC name is N-(2-benzylphenyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide.
| Compound Name | N-(2-benzylphenyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9128153 |
| Molecular Formula | C20H17N5OS |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-(2-benzylphenyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccsc2)n1)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C20H17N5OS/c26-19(13-25-23-20(22-24-25)17-10-11-27-14-17)21-18-9-5-4-8-16(18)12-15-6-2-1-3-7-15/h1-11,14H,12-13H2,(H,21,26) |
| InChIKey | WFTDGGNWEVOWGM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |