C15H15N5O3S — CID 9128117
N-(2,4-dimethoxyphenyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide (PubChem CID 9128117) has the molecular formula C15H15N5O3S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9128117 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2nnc(-c3ccsc3)n2)c(OC)c1 |
| InChI | InChI=1S/C15H15N5O3S/c1-22-11-3-4-12(13(7-11)23-2)16-14(21)8-20-18-15(17-19-20)10-5-6-24-9-10/h3-7,9H,8H2,1-2H3,(H,16,21) |
| InChIKey | XFSYUEOKEKRGDO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |