C12H15N5O2S — CID 115878438
N-[1-(hydroxymethyl)cyclobutyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetamide (PubChem CID 115878438) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclobutyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetamide.
| Compound Name | N-[1-(hydroxymethyl)cyclobutyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 115878438 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclobutyl]-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccsc2)n1)NC1(CO)CCC1 |
| InChI | InChI=1S/C12H15N5O2S/c18-8-12(3-1-4-12)13-10(19)6-17-15-11(14-16-17)9-2-5-20-7-9/h2,5,7,18H,1,3-4,6,8H2,(H,13,19) |
| InChIKey | BCSUOYKDOXNBFT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |