C18H15ClN4O3 — CID 8825511
[2-(4-chlorophenyl)-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate (PubChem CID 8825511) has the molecular formula C18H15ClN4O3 and a molecular weight of 370.80 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate |
|---|---|
| PubChem CID | 8825511 |
| Molecular Formula | C18H15ClN4O3 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate |
| SMILES | Cc1ccc(-c2nnn(CC(=O)OCC(=O)c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C18H15ClN4O3/c1-12-2-4-14(5-3-12)18-20-22-23(21-18)10-17(25)26-11-16(24)13-6-8-15(19)9-7-13/h2-9H,10-11H2,1H3 |
| InChIKey | NMTYVJLLQRNFFJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |