C19H17ClN4O3 — CID 8807248
[2-(4-ethylphenyl)-2-oxoethyl] 2-[5-(4-chlorophenyl)tetrazol-2-yl]acetate (PubChem CID 8807248) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-2-oxoethyl] 2-[5-(4-chlorophenyl)tetrazol-2-yl]acetate.
| Compound Name | [2-(4-ethylphenyl)-2-oxoethyl] 2-[5-(4-chlorophenyl)tetrazol-2-yl]acetate |
|---|---|
| PubChem CID | 8807248 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | [2-(4-ethylphenyl)-2-oxoethyl] 2-[5-(4-chlorophenyl)tetrazol-2-yl]acetate |
| SMILES | CCc1ccc(C(=O)COC(=O)Cn2nnc(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C19H17ClN4O3/c1-2-13-3-5-14(6-4-13)17(25)12-27-18(26)11-24-22-19(21-23-24)15-7-9-16(20)10-8-15/h3-10H,2,11-12H2,1H3 |
| InChIKey | YLFPAMSIDGFEOS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |