C17H15Cl2N5O — CID 2529123
N-[2-(4-chlorophenyl)ethyl]-2-[5-(4-chlorophenyl)tetrazol-2-yl]acetamide (PubChem CID 2529123) has the molecular formula C17H15Cl2N5O and a molecular weight of 376.25 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-[5-(4-chlorophenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-[5-(4-chlorophenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 2529123 |
| Molecular Formula | C17H15Cl2N5O |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-[5-(4-chlorophenyl)tetrazol-2-yl]acetamide |
| SMILES | O=C(Cn1nnc(-c2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2N5O/c18-14-5-1-12(2-6-14)9-10-20-16(25)11-24-22-17(21-23-24)13-3-7-15(19)8-4-13/h1-8H,9-11H2,(H,20,25) |
| InChIKey | UNCBNLSYVADFHK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |