C18H16F3N5O2 — CID 8598231
N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide (PubChem CID 8598231) has the molecular formula C18H16F3N5O2 and a molecular weight of 391.35 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 8598231 |
| Molecular Formula | C18H16F3N5O2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide |
| SMILES | O=C(Cn1nnc(-c2ccc(F)cc2)n1)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H16F3N5O2/c19-14-5-3-13(4-6-14)17-23-25-26(24-17)11-16(27)22-10-9-12-1-7-15(8-2-12)28-18(20)21/h1-8,18H,9-11H2,(H,22,27) |
| InChIKey | YNAKPPKHVILLJP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |