C22H25N5O3 — CID 8825534
[2-(4-tert-butylanilino)-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate (PubChem CID 8825534) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate.
| Compound Name | [2-(4-tert-butylanilino)-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate |
|---|---|
| PubChem CID | 8825534 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | [2-(4-tert-butylanilino)-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate |
| SMILES | Cc1ccc(-c2nnn(CC(=O)OCC(=O)Nc3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C22H25N5O3/c1-15-5-7-16(8-6-15)21-24-26-27(25-21)13-20(29)30-14-19(28)23-18-11-9-17(10-12-18)22(2,3)4/h5-12H,13-14H2,1-4H3,(H,23,28) |
| InChIKey | TTYQJLFJFLIKFX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |