C16H20N6O4 — CID 8825634
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate (PubChem CID 8825634) has the molecular formula C16H20N6O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate |
|---|---|
| PubChem CID | 8825634 |
| Molecular Formula | C16H20N6O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate |
| SMILES | Cc1ccc(-c2nnn(CC(=O)OCC(=O)NC(=O)NC(C)C)n2)cc1 |
| InChI | InChI=1S/C16H20N6O4/c1-10(2)17-16(25)18-13(23)9-26-14(24)8-22-20-15(19-21-22)12-6-4-11(3)5-7-12/h4-7,10H,8-9H2,1-3H3,(H2,17,18,23,25) |
| InChIKey | ZTQNEENEFRXWNO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |