C14H10Cl2N4O2S — CID 8677471
(3,4-dichlorophenyl)methyl 2-(5-thiophen-3-yltetrazol-2-yl)acetate (PubChem CID 8677471) has the molecular formula C14H10Cl2N4O2S and a molecular weight of 369.23 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 2-(5-thiophen-3-yltetrazol-2-yl)acetate.
| Compound Name | (3,4-dichlorophenyl)methyl 2-(5-thiophen-3-yltetrazol-2-yl)acetate |
|---|---|
| PubChem CID | 8677471 |
| Molecular Formula | C14H10Cl2N4O2S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 2-(5-thiophen-3-yltetrazol-2-yl)acetate |
| SMILES | O=C(Cn1nnc(-c2ccsc2)n1)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2N4O2S/c15-11-2-1-9(5-12(11)16)7-22-13(21)6-20-18-14(17-19-20)10-3-4-23-8-10/h1-5,8H,6-7H2 |
| InChIKey | UKQWEFYOXJQISA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |