C17H17N5O3S — CID 8677753
[(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 2-(5-thiophen-3-yltetrazol-2-yl)acetate (PubChem CID 8677753) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 2-(5-thiophen-3-yltetrazol-2-yl)acetate.
| Compound Name | [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 2-(5-thiophen-3-yltetrazol-2-yl)acetate |
|---|---|
| PubChem CID | 8677753 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 2-(5-thiophen-3-yltetrazol-2-yl)acetate |
| SMILES | Cc1ccc(NC(=O)[C@H](C)OC(=O)Cn2nnc(-c3ccsc3)n2)cc1 |
| InChI | InChI=1S/C17H17N5O3S/c1-11-3-5-14(6-4-11)18-17(24)12(2)25-15(23)9-22-20-16(19-21-22)13-7-8-26-10-13/h3-8,10,12H,9H2,1-2H3,(H,18,24)/t12-/m0/s1 |
| InChIKey | AQLJAKHYIHVTFF-LBPRGKRZSA-N |
| XLogP | 2.28 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |