C20H25N5O3S — CID 8677834
[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(5-thiophen-3-yltetrazol-2-yl)acetate (PubChem CID 8677834) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(5-thiophen-3-yltetrazol-2-yl)acetate.
| Compound Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(5-thiophen-3-yltetrazol-2-yl)acetate |
|---|---|
| PubChem CID | 8677834 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(5-thiophen-3-yltetrazol-2-yl)acetate |
| SMILES | C[C@H](OC(=O)Cn1nnc(-c2ccsc2)n1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H25N5O3S/c1-12(19(27)21-20-7-13-4-14(8-20)6-15(5-13)9-20)28-17(26)10-25-23-18(22-24-25)16-2-3-29-11-16/h2-3,11-15H,4-10H2,1H3,(H,21,27)/t12-,13?,14?,15?,20?/m0/s1 |
| InChIKey | ASVIGZWBKYMQMT-PGBBXINNSA-N |
| XLogP | 2.42 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |