C11H15NO3S2 — CID 43360065
4-[methyl-(2-thiophen-2-ylsulfanylacetyl)amino]butanoic acid (PubChem CID 43360065) has the molecular formula C11H15NO3S2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 4-[methyl-(2-thiophen-2-ylsulfanylacetyl)amino]butanoic acid.
| Compound Name | 4-[methyl-(2-thiophen-2-ylsulfanylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43360065 |
| Molecular Formula | C11H15NO3S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 4-[methyl-(2-thiophen-2-ylsulfanylacetyl)amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)CSc1cccs1 |
| InChI | InChI=1S/C11H15NO3S2/c1-12(6-2-4-10(14)15)9(13)8-17-11-5-3-7-16-11/h3,5,7H,2,4,6,8H2,1H3,(H,14,15) |
| InChIKey | VQEURXRBPDLGNJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |