C8H8O2S2 — CID 21268829
2-(thiophen-2-ylsulfanylmethyl)prop-2-enoic acid (PubChem CID 21268829) has the molecular formula C8H8O2S2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-(thiophen-2-ylsulfanylmethyl)prop-2-enoic acid.
| Compound Name | 2-(thiophen-2-ylsulfanylmethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 21268829 |
| Molecular Formula | C8H8O2S2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | 2-(thiophen-2-ylsulfanylmethyl)prop-2-enoic acid |
| SMILES | C=C(CSc1cccs1)C(=O)O |
| InChI | InChI=1S/C8H8O2S2/c1-6(8(9)10)5-12-7-3-2-4-11-7/h2-4H,1,5H2,(H,9,10) |
| InChIKey | WJDRFJYNRSCJJF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|