C9H11NO3S2 — CID 61131354
(2S)-2-[(2-thiophen-2-ylsulfanylacetyl)amino]propanoic acid (PubChem CID 61131354) has the molecular formula C9H11NO3S2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (2S)-2-[(2-thiophen-2-ylsulfanylacetyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(2-thiophen-2-ylsulfanylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 61131354 |
| Molecular Formula | C9H11NO3S2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | (2S)-2-[(2-thiophen-2-ylsulfanylacetyl)amino]propanoic acid |
| SMILES | C[C@H](NC(=O)CSc1cccs1)C(=O)O |
| InChI | InChI=1S/C9H11NO3S2/c1-6(9(12)13)10-7(11)5-15-8-3-2-4-14-8/h2-4,6H,5H2,1H3,(H,10,11)(H,12,13)/t6-/m0/s1 |
| InChIKey | JJRBQPNTNXUNOX-LURJTMIESA-N |
| XLogP | 1.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |