C10H13NO4S2 — CID 61244401
4-hydroxy-2-[(2-thiophen-2-ylsulfanylacetyl)amino]butanoic acid (PubChem CID 61244401) has the molecular formula C10H13NO4S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-hydroxy-2-[(2-thiophen-2-ylsulfanylacetyl)amino]butanoic acid.
| Compound Name | 4-hydroxy-2-[(2-thiophen-2-ylsulfanylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 61244401 |
| Molecular Formula | C10H13NO4S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 4-hydroxy-2-[(2-thiophen-2-ylsulfanylacetyl)amino]butanoic acid |
| SMILES | O=C(CSc1cccs1)NC(CCO)C(=O)O |
| InChI | InChI=1S/C10H13NO4S2/c12-4-3-7(10(14)15)11-8(13)6-17-9-2-1-5-16-9/h1-2,5,7,12H,3-4,6H2,(H,11,13)(H,14,15) |
| InChIKey | VFGJXGYTBDHSOQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |